Products 1251957-89-7
CAS 1251957-89-7 is the registry number for Magmas-IN-1. Offered by: MedChemExpress. Available pack sizes: 1 mg, 10 mg, 5 mg.
N-(diaminomethylidene)-4-[(E)-(3-ethyl-2,4,4-trimethylcyclohex-2-en-1-ylidene)methyl]benzamide (CAS 1251957-89-7) is a chemical compound with the molecular formula C20H27N3O and a molecular weight of 325.4 g/mol. IUPAC name: N-(diaminomethylidene)-4-[(E)-(3-ethyl-2,4,4-trimethylcyclohex-2-en-1-ylidene)methyl]benzamide. InChIKey: XSSNKBMVZGXBCU-FOWTUZBSSA-N.
| Molecular formula | C20H27N3O |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | N-(diaminomethylidene)-4-[(E)-(3-ethyl-2,4,4-trimethylcyclohex-2-en-1-ylidene)methyl]benzamide |
| InChIKey | XSSNKBMVZGXBCU-FOWTUZBSSA-N |
| SMILES | CCC1=C(/C(=C/C2=CC=C(C=C2)C(=O)N=C(N)N)/CCC1(C)C)C |
Computed by PubChem (NCBI)