CAS 1252173-44-6 is the registry number for 1-(3-Nitro-4-(thiazol-2-ylthio)phenyl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]ethanone (CAS 1252173-44-6) is a chemical compound with the molecular formula C11H8N2O3S2 and a molecular weight of 280.3 g/mol. IUPAC name: 1-[3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]ethanone. InChIKey: POBQXSCDYDLZMJ-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3S2 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 1-[3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]ethanone |
| InChIKey | POBQXSCDYDLZMJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)SC2=NC=CS2)[N+](=O)[O-] |
Computed by PubChem (NCBI)