Products 125229-60-9
CAS 125229-60-9 appears in our catalog under these names: L-Aspartic acid bis-allyl ester p-toluenesulfonate salt, 95%, (S)–Diallyl 2–aminosuccinate 4–methylbenzenesulfonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 1g, 5g, 250mg.
Bis(prop-2-enyl) (2S)-2-aminobutanedioate;4-methylbenzenesulfonic acid (CAS 125229-60-9) is a chemical compound with the molecular formula C17H23NO7S and a molecular weight of 385.4 g/mol. IUPAC name: bis(prop-2-enyl) (2S)-2-aminobutanedioate;4-methylbenzenesulfonic acid. InChIKey: AOWMVHRLCZAUDM-QRPNPIFTSA-N.
| Molecular formula | C17H23NO7S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | bis(prop-2-enyl) (2S)-2-aminobutanedioate;4-methylbenzenesulfonic acid |
| InChIKey | AOWMVHRLCZAUDM-QRPNPIFTSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C=CCOC(=O)C[C@@H](C(=O)OCC=C)N |
Computed by PubChem (NCBI)
Synonyms:
L-Aspartic acid bis-allyl ester p-toluenesulfonate salt, (S)-Diallyl 2-aminosuccinate 4-methylbenzenesulfonate, bis(prop-2-enyl) (2S)-2-aminobutanedioate;4-methylbenzenesulfonic acid, L-Aspartic acid diallyl ester p-toluenesulfonate salt, diallyl L-aspartate 4-methylbenzenesulfonate, 4-Methylbenzene-1-sulfonic acid--diprop-2-en-1-yl L-aspartate (1/1), bis(prop-2-enyl) (2S)-2-azanylbutanedioate;4-methylbenzenesulfonic acid, L-Aspartic acid-1,4-diallyl ester tosylate (H-L-Asp(All)-OAll.Tos)