Products 1252490-44-0
CAS 1252490-44-0 is the registry number for N-((4-Cyanophenyl)methanesulfonyl)-2-methyl-2-phenylpropanamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-[(4-cyanophenyl)methylsulfonyl]-2-methyl-2-phenylpropanamide (CAS 1252490-44-0) is a chemical compound with the molecular formula C18H18N2O3S and a molecular weight of 342.4 g/mol. IUPAC name: N-[(4-cyanophenyl)methylsulfonyl]-2-methyl-2-phenylpropanamide. InChIKey: XMYMNKWZSKOOCH-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O3S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | N-[(4-cyanophenyl)methylsulfonyl]-2-methyl-2-phenylpropanamide |
| InChIKey | XMYMNKWZSKOOCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(=O)NS(=O)(=O)CC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)