CAS 1252559-53-7 appears in our catalog under these names: N-(5-Methyl-1,3-thiazolidin-2-ylidene)pyridin-3-amine dihydrochloride, 95%, N-(5-Methyl-1,3-thiazolidin-2-ylidene)pyridin-3-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-methyl-N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine;dihydrochloride (CAS 1252559-53-7) is a chemical compound with the molecular formula C9H13Cl2N3S and a molecular weight of 266.19 g/mol. IUPAC name: 5-methyl-N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine;dihydrochloride. InChIKey: SOVBARGQUGTFJP-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3S |
|---|---|
| Molecular weight | 266.19 g/mol |
| IUPAC name | 5-methyl-N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine;dihydrochloride |
| InChIKey | SOVBARGQUGTFJP-UHFFFAOYSA-N |
| SMILES | CC1CN=C(S1)NC2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)