Products 1252883-50-3
CAS 1252883-50-3 is the registry number for N,4-Dimethyl-1-benzyl-3-piperidinamine-d3. Offered by: TRC. Available pack sizes: 25mg.
1-benzyl-4-methyl-N-(trideuteriomethyl)piperidin-3-amine (CAS 1252883-50-3) is a chemical compound with the molecular formula C14H22N2 and a molecular weight of 221.36 g/mol. IUPAC name: 1-benzyl-4-methyl-N-(trideuteriomethyl)piperidin-3-amine. InChIKey: NVKDDQBZODSEIN-BMSJAHLVSA-N.
| Molecular formula | C14H22N2 |
|---|---|
| Molecular weight | 221.36 g/mol |
| IUPAC name | 1-benzyl-4-methyl-N-(trideuteriomethyl)piperidin-3-amine |
| InChIKey | NVKDDQBZODSEIN-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])NC1CN(CCC1C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)