CAS 125292-34-4 appears in our catalog under these names: 5-Chloro-N-(1H-imidazol-2-yl)benzo[c][1,2,5]thiadiazol-4-amine, 98%, Dehydro Tizanidine, Tizanidine Impurity 10(Tizanidine Dehydro Impurity), Dehydro Tizanidine, >95% (HPLC), Dehydro Tizanidine-13C-15N2. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
5-chloro-N-(1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine (CAS 125292-34-4) is a chemical compound with the molecular formula C9H6ClN5S and a molecular weight of 251.70 g/mol. IUPAC name: 5-chloro-N-(1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine. InChIKey: SIXOTSDVJFHVJP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN5S |
|---|---|
| Molecular weight | 251.70 g/mol |
| IUPAC name | 5-chloro-N-(1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine |
| InChIKey | SIXOTSDVJFHVJP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1Cl)NC3=NC=CN3 |
Computed by PubChem (NCBI)