CAS 1253-46-9 appears in our catalog under these names: (4-Methoxycarbonylbenzyl)triphenylphosphonium bromide, 95%, (4–Methoxycarbonylbenzyl) triphenylphosphine bromide, [4-(Methoxycarbonyl)benzyl](triphenyl)phosphonium bromide 98%, [4-(Methoxycarbonyl)Benzyl](Triphenyl)Phosphonium Bromide, 99%, 99%, (4-methoxycarbonylphenyl)methyl-triphenylphosphanium,bromide, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 25g, 100g.
(4-methoxycarbonylphenyl)methyl-triphenylphosphanium bromide (CAS 1253-46-9) is a chemical compound with the molecular formula C27H24BrO2P and a molecular weight of 491.4 g/mol. IUPAC name: (4-methoxycarbonylphenyl)methyl-triphenylphosphanium bromide. InChIKey: WUWDGVKUXDZLNU-UHFFFAOYSA-M.
| Molecular formula | C27H24BrO2P |
|---|---|
| Molecular weight | 491.4 g/mol |
| IUPAC name | (4-methoxycarbonylphenyl)methyl-triphenylphosphanium bromide |
| InChIKey | WUWDGVKUXDZLNU-UHFFFAOYSA-M |
| SMILES | COC(=O)C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)