CAS 1253-47-0 appears in our catalog under these names: 4-Carbomethoxybenzyl triphenylphosphonium chloride, 97%, (4–(Methoxycarbonyl)benzyl)triphenylphosphonium chloride, (4-Methoxycarbonylbenzyl)triphenylphosphonium chloride, 97% , (4-(Methoxycarbonyl)benzyl)triphenylphosphonium chloride 95+%, 4-Carbomethoxybenzyl triphenylphosphonium chloride, 95+%, 95+%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
(4-methoxycarbonylphenyl)methyl-triphenylphosphanium chloride (CAS 1253-47-0) is a chemical compound with the molecular formula C27H24ClO2P and a molecular weight of 446.9 g/mol. IUPAC name: (4-methoxycarbonylphenyl)methyl-triphenylphosphanium chloride. InChIKey: NKKAHXNONUTMEY-UHFFFAOYSA-M.
| Molecular formula | C27H24ClO2P |
|---|---|
| Molecular weight | 446.9 g/mol |
| IUPAC name | (4-methoxycarbonylphenyl)methyl-triphenylphosphanium chloride |
| InChIKey | NKKAHXNONUTMEY-UHFFFAOYSA-M |
| SMILES | COC(=O)C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)