CAS 125313-45-3 is the registry number for 3-(1-Methyl-1H-indol-3-yl)-4-(thiophen-3-yl)-1H-pyrrole-2,5-dione, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-(1-methylindol-3-yl)-4-thiophen-3-ylpyrrole-2,5-dione (CAS 125313-45-3) is a chemical compound with the molecular formula C17H12N2O2S and a molecular weight of 308.4 g/mol. IUPAC name: 3-(1-methylindol-3-yl)-4-thiophen-3-ylpyrrole-2,5-dione. InChIKey: QSWVIVJBWVSRRV-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O2S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 3-(1-methylindol-3-yl)-4-thiophen-3-ylpyrrole-2,5-dione |
| InChIKey | QSWVIVJBWVSRRV-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CSC=C4 |
Computed by PubChem (NCBI)