CAS 125320-20-9 appears in our catalog under these names: {(4-(bromomethyl)phenyl)methoxy}(tert-butyl)dimethylsilane, 95%, {(4-(Bromomethyl)phenyl)methoxy}(tert-butyl)dimethylsilane. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
[4-(bromomethyl)phenyl]methoxy-tert-butyl-dimethylsilane (CAS 125320-20-9) is a chemical compound with the molecular formula C14H23BrOSi and a molecular weight of 315.32 g/mol. IUPAC name: [4-(bromomethyl)phenyl]methoxy-tert-butyl-dimethylsilane. InChIKey: IDDZPNNNGHOHDX-UHFFFAOYSA-N.
| Molecular formula | C14H23BrOSi |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | [4-(bromomethyl)phenyl]methoxy-tert-butyl-dimethylsilane |
| InChIKey | IDDZPNNNGHOHDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC=C(C=C1)CBr |
Computed by PubChem (NCBI)