CAS 1253297-28-7 is the registry number for Benzo[d][1,2,3]thiadiazole-5-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3-benzothiadiazole-5-sulfonyl chloride (CAS 1253297-28-7) is a chemical compound with the molecular formula C6H3ClN2O2S2 and a molecular weight of 234.7 g/mol. IUPAC name: 1,2,3-benzothiadiazole-5-sulfonyl chloride. InChIKey: OXAMHOIIOYWJES-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O2S2 |
|---|---|
| Molecular weight | 234.7 g/mol |
| IUPAC name | 1,2,3-benzothiadiazole-5-sulfonyl chloride |
| InChIKey | OXAMHOIIOYWJES-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)N=NS2 |
Computed by PubChem (NCBI)