CAS 125335-70-8 appears in our catalog under these names: (3S,3aR,6S,6aR)-hexahydrofuro[3,2-b]furan-3,6-diamine, 97%, 97%, (3S,3aR,6S,6aR)-Hexahydrofuro[3,2-b]furan-3,6-diamine, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3S,3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine (CAS 125335-70-8) is a chemical compound with the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. IUPAC name: (3S,3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine. InChIKey: XHQWSUCHPAVLNQ-UNTFVMJOSA-N.
| Molecular formula | C6H12N2O2 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | (3S,3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine |
| InChIKey | XHQWSUCHPAVLNQ-UNTFVMJOSA-N |
| SMILES | C1[C@@H]([C@@H]2[C@H](O1)[C@H](CO2)N)N |
Computed by PubChem (NCBI)