Products 1253527-87-5

CAS 1253527-87-5 is the registry number for 3-((4-(Benzyloxy)benzyl)thio)-3-phenylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-phenyl-3-[(4-phenylmethoxyphenyl)methylsulfanyl]propanoic acid (CAS 1253527-87-5) is a chemical compound with the molecular formula C23H22O3S and a molecular weight of 378.5 g/mol. IUPAC name: 3-phenyl-3-[(4-phenylmethoxyphenyl)methylsulfanyl]propanoic acid. InChIKey: IUUQWDFKMNXNTI-UHFFFAOYSA-N.

Identity
Molecular formulaC23H22O3S
Molecular weight378.5 g/mol
IUPAC name3-phenyl-3-[(4-phenylmethoxyphenyl)methylsulfanyl]propanoic acid
InChIKeyIUUQWDFKMNXNTI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=C(C=C2)CSC(CC(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)