Products 1253528-22-1

CAS 1253528-22-1 is the registry number for 2-((4-(Benzhydryloxy)benzyl)thio)-2-phenylacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-benzhydryloxyphenyl)methylsulfanyl]-2-phenylacetic acid (CAS 1253528-22-1) is a chemical compound with the molecular formula C28H24O3S and a molecular weight of 440.6 g/mol. IUPAC name: 2-[(4-benzhydryloxyphenyl)methylsulfanyl]-2-phenylacetic acid. InChIKey: FQOOEBRVIGLHBW-UHFFFAOYSA-N.

Identity
Molecular formulaC28H24O3S
Molecular weight440.6 g/mol
IUPAC name2-[(4-benzhydryloxyphenyl)methylsulfanyl]-2-phenylacetic acid
InChIKeyFQOOEBRVIGLHBW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)OC3=CC=C(C=C3)CSC(C4=CC=CC=C4)C(=O)O

Computed by PubChem (NCBI)