CAS 1253569-14-0 is the registry number for 4-Chloro-N,N-bis(4-methoxybenzyl)-6-methyl-1,3,5-triazin-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-chloro-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine (CAS 1253569-14-0) is a chemical compound with the molecular formula C20H21ClN4O2 and a molecular weight of 384.9 g/mol. IUPAC name: 4-chloro-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine. InChIKey: DLOHVOOEEYQCOC-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN4O2 |
|---|---|
| Molecular weight | 384.9 g/mol |
| IUPAC name | 4-chloro-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine |
| InChIKey | DLOHVOOEEYQCOC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=N1)Cl)N(CC2=CC=C(C=C2)OC)CC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)