Products 1253584-78-9
CAS 1253584-78-9 is the registry number for Hsp90-IN-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[2,4-dihydroxy-6-(4-nitrophenoxy)phenyl]-N-piperidin-4-yl-1,2-oxazole-3-carboxamide (CAS 1253584-78-9) is a chemical compound with the molecular formula C21H20N4O7 and a molecular weight of 440.4 g/mol. IUPAC name: 5-[2,4-dihydroxy-6-(4-nitrophenoxy)phenyl]-N-piperidin-4-yl-1,2-oxazole-3-carboxamide. InChIKey: WPCKTHWXJWRNOP-UHFFFAOYSA-N.
| Molecular formula | C21H20N4O7 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | 5-[2,4-dihydroxy-6-(4-nitrophenoxy)phenyl]-N-piperidin-4-yl-1,2-oxazole-3-carboxamide |
| InChIKey | WPCKTHWXJWRNOP-UHFFFAOYSA-N |
| SMILES | C1CNCCC1NC(=O)C2=NOC(=C2)C3=C(C=C(C=C3OC4=CC=C(C=C4)[N+](=O)[O-])O)O |
Computed by PubChem (NCBI)
Synonyms:
Hsp90-IN-17, orb1744513