CAS 1253690-81-1 is the registry number for (S)-((1S,2S,4S,5R)-5-Ethylquinuclidin-2-yl)(quinolin-4-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(S)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanamine (CAS 1253690-81-1) is a chemical compound with the molecular formula C19H25N3 and a molecular weight of 295.4 g/mol. IUPAC name: (S)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanamine. InChIKey: FICGKKWNGWEQKW-LSOMNZGLSA-N.
| Molecular formula | C19H25N3 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | (S)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanamine |
| InChIKey | FICGKKWNGWEQKW-LSOMNZGLSA-N |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@H]2[C@H](C3=CC=NC4=CC=CC=C34)N |
Computed by PubChem (NCBI)