CAS 1253696-35-3 is the registry number for 6-Formylpyrazolo(1,5-a)pyrimidine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-formylpyrazolo[1,5-a]pyrimidine-3-carbonitrile (CAS 1253696-35-3) is a chemical compound with the molecular formula C8H4N4O and a molecular weight of 172.14 g/mol. IUPAC name: 6-formylpyrazolo[1,5-a]pyrimidine-3-carbonitrile. InChIKey: YRXCWLJVNBJLCU-UHFFFAOYSA-N.
| Molecular formula | C8H4N4O |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 6-formylpyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| InChIKey | YRXCWLJVNBJLCU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C(C=NN21)C#N)C=O |
Computed by PubChem (NCBI)