CAS 1253739-14-8 is the registry number for CGGK. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-6-amino-2-[[2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]acetyl]amino]acetyl]amino]hexanoic acid (CAS 1253739-14-8) is a chemical compound with the molecular formula C13H25N5O5S and a molecular weight of 363.44 g/mol. IUPAC name: (2S)-6-amino-2-[[2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]acetyl]amino]acetyl]amino]hexanoic acid. InChIKey: VBVAVFMEOSMTQB-IUCAKERBSA-N.
| Molecular formula | C13H25N5O5S |
|---|---|
| Molecular weight | 363.44 g/mol |
| IUPAC name | (2S)-6-amino-2-[[2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]acetyl]amino]acetyl]amino]hexanoic acid |
| InChIKey | VBVAVFMEOSMTQB-IUCAKERBSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)O)NC(=O)CNC(=O)CNC(=O)[C@H](CS)N |
Computed by PubChem (NCBI)