CAS 1253789-74-0 appears in our catalog under these names: 1-(5-Bromo-1H-indol-7-yl)ethanone, 95+%, 7-ACETYL-5-BROMOINDOLE, 96%. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 250MG.
1-(5-bromo-1H-indol-7-yl)ethanone (CAS 1253789-74-0) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 1-(5-bromo-1H-indol-7-yl)ethanone. InChIKey: LPQKQTUKOZNLJQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 1-(5-bromo-1H-indol-7-yl)ethanone |
| InChIKey | LPQKQTUKOZNLJQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=CC(=C1)Br)C=CN2 |
Computed by PubChem (NCBI)