CAS 1253799-29-9 appears in our catalog under these names: Phenyl 2-(benzyloxy)-3-(dibenzylamino)-5-fluoro-6-methylbenzoate, 95%, Phenyl 2–(benzyloxy)–3–(dibenzylamino)–5–fluoro–6–methylbenzoate, TP-353/ 99.98% (existing batch purity), 3-(Bis(phenylmethyl)amino)-5-fluoro-6-methyl-2-(phenylmethoxy)benzoic acid phenyl ester, TP353 97%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 1mg, 2mg, 5mg, 10mg, 25mg.
Phenyl 5-(dibenzylamino)-3-fluoro-2-methyl-6-phenylmethoxybenzoate (CAS 1253799-29-9) is a chemical compound with the molecular formula C35H30FNO3 and a molecular weight of 531.6 g/mol. IUPAC name: phenyl 5-(dibenzylamino)-3-fluoro-2-methyl-6-phenylmethoxybenzoate. InChIKey: VRXGVVAMXZXKNA-UHFFFAOYSA-N.
| Molecular formula | C35H30FNO3 |
|---|---|
| Molecular weight | 531.6 g/mol |
| IUPAC name | phenyl 5-(dibenzylamino)-3-fluoro-2-methyl-6-phenylmethoxybenzoate |
| InChIKey | VRXGVVAMXZXKNA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1C(=O)OC2=CC=CC=C2)OCC3=CC=CC=C3)N(CC4=CC=CC=C4)CC5=CC=CC=C5)F |
Computed by PubChem (NCBI)