CAS 1253926-20-3 appears in our catalog under these names: 4-Bromo-3-fluoroindole, 4–Bromo–3–fluoroindole. Offered by: TRC, GLPBio. Available pack sizes: 250mg, 1g.
4-bromo-3-fluoro-1H-indole (CAS 1253926-20-3) is a chemical compound with the molecular formula C8H5BrFN and a molecular weight of 214.03 g/mol. IUPAC name: 4-bromo-3-fluoro-1H-indole. InChIKey: ZOFFOMXCMHIBOI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFN |
|---|---|
| Molecular weight | 214.03 g/mol |
| IUPAC name | 4-bromo-3-fluoro-1H-indole |
| InChIKey | ZOFFOMXCMHIBOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)F |
Computed by PubChem (NCBI)