Products 1253971-15-1
CAS 1253971-15-1 is the registry number for 2-(4'-Bromo[1,1'-biphenyl]-4-yl)benzoxazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
2-[4-(4-bromophenyl)phenyl]-1,3-benzoxazole (CAS 1253971-15-1) is a chemical compound with the molecular formula C19H12BrNO and a molecular weight of 350.2 g/mol. IUPAC name: 2-[4-(4-bromophenyl)phenyl]-1,3-benzoxazole. InChIKey: ACLQMQMRQOYAFB-UHFFFAOYSA-N.
| Molecular formula | C19H12BrNO |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 2-[4-(4-bromophenyl)phenyl]-1,3-benzoxazole |
| InChIKey | ACLQMQMRQOYAFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC=C(C=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)