CAS 1253978-24-3 appears in our catalog under these names: (E)-3-(3-(2-Chlorophenyl)acryloyl)-2H-chromen-2-one, 98%, 98%, MAO-B-IN-2/ 97.28% (existing batch purity), MAO–B–IN–2, MAO-B-IN-2, 99.05%. Offered by: Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 25mg, 100mg, 1mg, 5mg, 10mg, 50mg, 10mM/1mL, 25 mg.
3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]chromen-2-one (CAS 1253978-24-3) is a chemical compound with the molecular formula C18H11ClO3 and a molecular weight of 310.7 g/mol. IUPAC name: 3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]chromen-2-one. InChIKey: TVTIXYCYMBPAFW-MDZDMXLPSA-N.
| Molecular formula | C18H11ClO3 |
|---|---|
| Molecular weight | 310.7 g/mol |
| IUPAC name | 3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]chromen-2-one |
| InChIKey | TVTIXYCYMBPAFW-MDZDMXLPSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)/C=C/C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)