CAS 1254032-67-1 is the registry number for Netarsudil Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[(2R)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate (CAS 1254032-67-1) is a chemical compound with the molecular formula C28H27N3O3 and a molecular weight of 453.5 g/mol. IUPAC name: [4-[(2R)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate. InChIKey: OURRXQUGYQRVML-SANMLTNESA-N.
| Molecular formula | C28H27N3O3 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | [4-[(2R)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate |
| InChIKey | OURRXQUGYQRVML-SANMLTNESA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)OCC2=CC=C(C=C2)[C@H](CN)C(=O)NC3=CC4=C(C=C3)C=NC=C4)C |
Computed by PubChem (NCBI)