CAS 1254040-46-4 is the registry number for 3,5,7-Trihydroxy-2-(4-(trifluoromethyl)phenyl)-4H-chromen-4-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3,5,7-trihydroxy-2-[4-(trifluoromethyl)phenyl]chromen-4-one (CAS 1254040-46-4) is a chemical compound with the molecular formula C16H9F3O5 and a molecular weight of 338.23 g/mol. IUPAC name: 3,5,7-trihydroxy-2-[4-(trifluoromethyl)phenyl]chromen-4-one. InChIKey: WSDFAXFXVNFMSF-UHFFFAOYSA-N.
| Molecular formula | C16H9F3O5 |
|---|---|
| Molecular weight | 338.23 g/mol |
| IUPAC name | 3,5,7-trihydroxy-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
| InChIKey | WSDFAXFXVNFMSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)C(F)(F)F |
Computed by PubChem (NCBI)