CAS 1254044-41-1 appears in our catalog under these names: Mito–apocynin (C2), Mito-apocynin (C2), Mito-apocynin (C2), 98.38%, 98.38%, Mito-apocynin (C2), 98.38%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg, 50 mg.
2-[(4-hydroxy-3-methoxybenzoyl)amino]ethyl-triphenylphosphanium bromide (CAS 1254044-41-1) is a chemical compound with the molecular formula C28H27BrNO3P and a molecular weight of 536.4 g/mol. IUPAC name: 2-[(4-hydroxy-3-methoxybenzoyl)amino]ethyl-triphenylphosphanium bromide. InChIKey: VCBKDUGPZYICTB-UHFFFAOYSA-N.
| Molecular formula | C28H27BrNO3P |
|---|---|
| Molecular weight | 536.4 g/mol |
| IUPAC name | 2-[(4-hydroxy-3-methoxybenzoyl)amino]ethyl-triphenylphosphanium bromide |
| InChIKey | VCBKDUGPZYICTB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)NCC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)O.[Br-] |
Computed by PubChem (NCBI)