CAS 1254047-46-5 is the registry number for 2-Fluoroanisole-d3. Offered by: TRC. Available pack sizes: 1g.
1-fluoro-2-(trideuteriomethoxy)benzene (CAS 1254047-46-5) is a chemical compound with the molecular formula C7H7FO and a molecular weight of 129.15 g/mol. IUPAC name: 1-fluoro-2-(trideuteriomethoxy)benzene. InChIKey: JIXDOBAQOWOUPA-FIBGUPNXSA-N.
| Molecular formula | C7H7FO |
|---|---|
| Molecular weight | 129.15 g/mol |
| IUPAC name | 1-fluoro-2-(trideuteriomethoxy)benzene |
| InChIKey | JIXDOBAQOWOUPA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1F |
Computed by PubChem (NCBI)