CAS 1254176-87-8 is the registry number for NEP28. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-bromo-5-[propyl(2,2,2-trifluoroethyl)amino]thiophene-2-carbonitrile (CAS 1254176-87-8) is a chemical compound with the molecular formula C10H10BrF3N2S and a molecular weight of 327.17 g/mol. IUPAC name: 3-bromo-5-[propyl(2,2,2-trifluoroethyl)amino]thiophene-2-carbonitrile. InChIKey: OLCJCOHUOJPPBI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3N2S |
|---|---|
| Molecular weight | 327.17 g/mol |
| IUPAC name | 3-bromo-5-[propyl(2,2,2-trifluoroethyl)amino]thiophene-2-carbonitrile |
| InChIKey | OLCJCOHUOJPPBI-UHFFFAOYSA-N |
| SMILES | CCCN(CC(F)(F)F)C1=CC(=C(S1)C#N)Br |
Computed by PubChem (NCBI)