Products 1254318-44-9
CAS 1254318-44-9 is the registry number for AZD5248. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 1 mg.
4-amino-N-[(1S)-1-cyano-2-[4-(4-cyanophenyl)phenyl]ethyl]oxane-4-carboxamide (CAS 1254318-44-9) is a chemical compound with the molecular formula C22H22N4O2 and a molecular weight of 374.4 g/mol. IUPAC name: 4-amino-N-[(1S)-1-cyano-2-[4-(4-cyanophenyl)phenyl]ethyl]oxane-4-carboxamide. InChIKey: NNUFRZJZOXVZIT-FQEVSTJZSA-N.
| Molecular formula | C22H22N4O2 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 4-amino-N-[(1S)-1-cyano-2-[4-(4-cyanophenyl)phenyl]ethyl]oxane-4-carboxamide |
| InChIKey | NNUFRZJZOXVZIT-FQEVSTJZSA-N |
| SMILES | C1COCCC1(C(=O)N[C@@H](CC2=CC=C(C=C2)C3=CC=C(C=C3)C#N)C#N)N |
Computed by PubChem (NCBI)