CAS 125455-61-0 appears in our catalog under these names: H-Gly-arg-pna dihydrochloride, 95%, H-Gly-Arg-pNA dihydrochloride, H–Gly–Arg–pNA (hydrochloride), Glycyl-N-(4-nitrophenyl)-L-argininamide dihydrochloride, H-Gly-Arg-pna dihydrochloride, min. 95 %, 25 mg. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.
2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;hydrochloride (CAS 125455-61-0) is a chemical compound with the molecular formula C14H22ClN7O4 and a molecular weight of 387.82 g/mol. IUPAC name: 2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;hydrochloride. InChIKey: MGFMNXNZZCRYAQ-UHFFFAOYSA-N.
| Molecular formula | C14H22ClN7O4 |
|---|---|
| Molecular weight | 387.82 g/mol |
| IUPAC name | 2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;hydrochloride |
| InChIKey | MGFMNXNZZCRYAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C(CCCN=C(N)N)NC(=O)CN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)