CAS 1254579-15-1 appears in our catalog under these names: 2,6-Benzothiazolediamine, N6-ethyl-4,5,6,7-tetrahydro-, (6S)-, 98%, Ethyl Pramipexole, Pramipexole Impurity 52, Pramipexole Impurity 11（Pramipexole Ethylamino Analog）, Ethyl pramipexole dihydrochloride. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6S)-6-N-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 1254579-15-1) is a chemical compound with the molecular formula C9H15N3S and a molecular weight of 197.30 g/mol. IUPAC name: (6S)-6-N-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: AXRIBUURQVTZPJ-LURJTMIESA-N.
| Molecular formula | C9H15N3S |
|---|---|
| Molecular weight | 197.30 g/mol |
| IUPAC name | (6S)-6-N-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | AXRIBUURQVTZPJ-LURJTMIESA-N |
| SMILES | CCN[C@H]1CCC2=C(C1)SC(=N2)N |
Computed by PubChem (NCBI)