Products 125481-77-8
CAS 125481-77-8 appears in our catalog under these names: 5-TAMRA chloride(91809-66-4 free base)/ 99.14% (existing batch purity), 5-TAMRA chloride(91809-66-4 free base). Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
[9-(2,4-dicarboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium chloride (CAS 125481-77-8) is a chemical compound with the molecular formula C25H23ClN2O5 and a molecular weight of 466.9 g/mol. IUPAC name: [9-(2,4-dicarboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium chloride. InChIKey: JDYDJBWXPVOQBZ-UHFFFAOYSA-N.
| Molecular formula | C25H23ClN2O5 |
|---|---|
| Molecular weight | 466.9 g/mol |
| IUPAC name | [9-(2,4-dicarboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium chloride |
| InChIKey | JDYDJBWXPVOQBZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)C(=O)O)C(=O)O.[Cl-] |
Computed by PubChem (NCBI)