CAS 1254841-08-1 is the registry number for (5S)–isopropyl 2–acetamido–6–amino–5–(2,3–difluorophenyl)hexanoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Propan-2-yl (5S)-2-acetamido-6-amino-5-(2,3-difluorophenyl)hexanoate (CAS 1254841-08-1) is a chemical compound with the molecular formula C17H24F2N2O3 and a molecular weight of 342.4 g/mol. IUPAC name: propan-2-yl (5S)-2-acetamido-6-amino-5-(2,3-difluorophenyl)hexanoate. InChIKey: UAOJVIDFOUWGEG-KEKZHRQWSA-N.
| Molecular formula | C17H24F2N2O3 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | propan-2-yl (5S)-2-acetamido-6-amino-5-(2,3-difluorophenyl)hexanoate |
| InChIKey | UAOJVIDFOUWGEG-KEKZHRQWSA-N |
| SMILES | CC(C)OC(=O)C(CC[C@H](CN)C1=C(C(=CC=C1)F)F)NC(=O)C |
Computed by PubChem (NCBI)