CAS 1255-78-3 is the registry number for 2-(4-(Benzyloxy)-3-methoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)chromen-4-one (CAS 1255-78-3) is a chemical compound with the molecular formula C25H22O6 and a molecular weight of 418.4 g/mol. IUPAC name: 5,7-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)chromen-4-one. InChIKey: TZHVNROPMAVPNR-UHFFFAOYSA-N.
| Molecular formula | C25H22O6 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 5,7-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)chromen-4-one |
| InChIKey | TZHVNROPMAVPNR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C=C(O2)C3=CC(=C(C=C3)OCC4=CC=CC=C4)OC |
Computed by PubChem (NCBI)