Products 1255147-75-1

CAS 1255147-75-1 is the registry number for 5-[3-Fluoro-5-(trifluoromethyl)phenoxy]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-[3-fluoro-5-(trifluoromethyl)phenoxy]furan-2-carboxylic acid (CAS 1255147-75-1) is a chemical compound with the molecular formula C12H6F4O4 and a molecular weight of 290.17 g/mol. IUPAC name: 5-[3-fluoro-5-(trifluoromethyl)phenoxy]furan-2-carboxylic acid. InChIKey: MRBYFFDOXJVZMS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6F4O4
Molecular weight290.17 g/mol
IUPAC name5-[3-fluoro-5-(trifluoromethyl)phenoxy]furan-2-carboxylic acid
InChIKeyMRBYFFDOXJVZMS-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)OC2=CC(=CC(=C2)C(F)(F)F)F)C(=O)O

Computed by PubChem (NCBI)