CAS 125517-45-5 is the registry number for (+)-Saxalin. Offered by: MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg.
4-(3-chloro-2-hydroxy-3-methylbutoxy)furo[3,2-g]chromen-7-one (CAS 125517-45-5) is a chemical compound with the molecular formula C16H15ClO5 and a molecular weight of 322.74 g/mol. IUPAC name: 4-(3-chloro-2-hydroxy-3-methylbutoxy)furo[3,2-g]chromen-7-one. InChIKey: QPHPWCUVCZXUEP-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO5 |
|---|---|
| Molecular weight | 322.74 g/mol |
| IUPAC name | 4-(3-chloro-2-hydroxy-3-methylbutoxy)furo[3,2-g]chromen-7-one |
| InChIKey | QPHPWCUVCZXUEP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(COC1=C2C=CC(=O)OC2=CC3=C1C=CO3)O)Cl |
Computed by PubChem (NCBI)