Products 1255309-10-4
CAS 1255309-10-4 appears in our catalog under these names: 11H-Benzo[4,5]thieno[3,2-b]carbazole, 98%, 98%, 11H-Benzo[4,5]thieno[3,2-b]carbazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
11H-[1]benzothiolo[3,2-b]carbazole (CAS 1255309-10-4) is a chemical compound with the molecular formula C18H11NS and a molecular weight of 273.4 g/mol. IUPAC name: 11H-[1]benzothiolo[3,2-b]carbazole. InChIKey: CARKIFYHLOQVHM-UHFFFAOYSA-N.
| Molecular formula | C18H11NS |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 11H-[1]benzothiolo[3,2-b]carbazole |
| InChIKey | CARKIFYHLOQVHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=C4C5=CC=CC=C5SC4=C3 |
Computed by PubChem (NCBI)