CAS 206447-68-9 appears in our catalog under these names: 12H-[1]Benzothieno[3,2-a]carbazole, 98%, 98%, 12H-benzo[4,5]thieno[3,2-a]carbazole, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
12H-[1]benzothiolo[3,2-a]carbazole (CAS 206447-68-9) is a chemical compound with the molecular formula C18H11NS and a molecular weight of 273.4 g/mol. IUPAC name: 12H-[1]benzothiolo[3,2-a]carbazole. InChIKey: GLYYLMBVQZMMMS-UHFFFAOYSA-N.
| Molecular formula | C18H11NS |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 12H-[1]benzothiolo[3,2-a]carbazole |
| InChIKey | GLYYLMBVQZMMMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)SC5=CC=CC=C54 |
Computed by PubChem (NCBI)