CAS 1255311-63-7 appears in our catalog under these names: 2-Cyclopropyl-4-nitropyridine, 95%, 2-Cyclopropyl-4-nitropyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-cyclopropyl-4-nitropyridine (CAS 1255311-63-7) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: 2-cyclopropyl-4-nitropyridine. InChIKey: ZWGBCDQRQJOMMV-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 2-cyclopropyl-4-nitropyridine |
| InChIKey | ZWGBCDQRQJOMMV-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)