Products 1255517-75-9
CAS 1255517-75-9 appears in our catalog under these names: Amitraz metabolite-d3, D3-Amitraz Metabolite BTS 27271, D3-Amitraz Metabolite BTS 27271, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: MedChemExpress, HPC Standards. Available pack sizes: 1 mg, 5 mg, 10 mg, 1x10mg, 1x1ml.
N-(2,4-dimethylphenyl)-N'-(trideuteriomethyl)methanimidamide (CAS 1255517-75-9) is a chemical compound with the molecular formula C10H14N2 and a molecular weight of 165.25 g/mol. IUPAC name: N-(2,4-dimethylphenyl)-N'-(trideuteriomethyl)methanimidamide. InChIKey: JIIOLEGNERQDIP-HPRDVNIFSA-N.
| Molecular formula | C10H14N2 |
|---|---|
| Molecular weight | 165.25 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)-N'-(trideuteriomethyl)methanimidamide |
| InChIKey | JIIOLEGNERQDIP-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N=CNC1=C(C=C(C=C1)C)C |
Computed by PubChem (NCBI)