CAS 125552-97-8 is the registry number for Azomethine HR. Offered by: TRC. Available pack sizes: 250mg.
4-[(2,4-dihydroxyphenyl)methylideneamino]-5-hydroxynaphthalene-2,7-disulfonic acid (CAS 125552-97-8) is a chemical compound with the molecular formula C17H13NO9S2 and a molecular weight of 439.4 g/mol. IUPAC name: 4-[(2,4-dihydroxyphenyl)methylideneamino]-5-hydroxynaphthalene-2,7-disulfonic acid. InChIKey: SUUGTVPLTSIKIZ-UHFFFAOYSA-N.
| Molecular formula | C17H13NO9S2 |
|---|---|
| Molecular weight | 439.4 g/mol |
| IUPAC name | 4-[(2,4-dihydroxyphenyl)methylideneamino]-5-hydroxynaphthalene-2,7-disulfonic acid |
| InChIKey | SUUGTVPLTSIKIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C=NC2=C3C(=CC(=C2)S(=O)(=O)O)C=C(C=C3O)S(=O)(=O)O |
Computed by PubChem (NCBI)