CAS 1255574-38-9 is the registry number for 2,5-Difluoro-4-(1H-tetrazol-1-yl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2,5-difluoro-4-(tetrazol-1-yl)phenol (CAS 1255574-38-9) is a chemical compound with the molecular formula C7H4F2N4O and a molecular weight of 198.13 g/mol. IUPAC name: 2,5-difluoro-4-(tetrazol-1-yl)phenol. InChIKey: GEAURNZYUSYOAH-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N4O |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 2,5-difluoro-4-(tetrazol-1-yl)phenol |
| InChIKey | GEAURNZYUSYOAH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)O)F)N2C=NN=N2 |
Computed by PubChem (NCBI)