CAS 1255574-65-2 is the registry number for N,N-Bis(t-Boc) 3,4-difluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Tert-butyl N-(3,4-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1255574-65-2) is a chemical compound with the molecular formula C16H21F2NO4 and a molecular weight of 329.34 g/mol. IUPAC name: tert-butyl N-(3,4-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: OAUWBPIKAQYWJI-UHFFFAOYSA-N.
| Molecular formula | C16H21F2NO4 |
|---|---|
| Molecular weight | 329.34 g/mol |
| IUPAC name | tert-butyl N-(3,4-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | OAUWBPIKAQYWJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CC(=C(C=C1)F)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)