Products 1255644-45-1
CAS 1255644-45-1 is the registry number for 3-Methylglutaconic acid-13C3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(E)-3-(113C)methyl(2,4-13C2)pent-2-enedioic acid (CAS 1255644-45-1) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 147.10 g/mol. IUPAC name: (E)-3-(113C)methyl(2,4-13C2)pent-2-enedioic acid. InChIKey: WKRBKYFIJPGYQC-UDKQHVDBSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 147.10 g/mol |
| IUPAC name | (E)-3-(113C)methyl(2,4-13C2)pent-2-enedioic acid |
| InChIKey | WKRBKYFIJPGYQC-UDKQHVDBSA-N |
| SMILES | [13CH3]/C(=[13CH]\C(=O)O)/[13CH2]C(=O)O |
Computed by PubChem (NCBI)