CAS 1255704-24-5 appears in our catalog under these names: Heronapyrrole B, Heronapyrrole B. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 250μg, 5mg, 10mg, 25mg, 50mg, Get quote.
(E,2R,3S,10S)-3,7,11-trimethyl-1-(5-nitro-1H-pyrrol-3-yl)dodec-6-ene-2,3,10,11-tetrol (CAS 1255704-24-5) is a chemical compound with the molecular formula C19H32N2O6 and a molecular weight of 384.5 g/mol. IUPAC name: (E,2R,3S,10S)-3,7,11-trimethyl-1-(5-nitro-1H-pyrrol-3-yl)dodec-6-ene-2,3,10,11-tetrol. InChIKey: IQLMWMXFFNAONP-WJEGLXPMSA-N.
| Molecular formula | C19H32N2O6 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | (E,2R,3S,10S)-3,7,11-trimethyl-1-(5-nitro-1H-pyrrol-3-yl)dodec-6-ene-2,3,10,11-tetrol |
| InChIKey | IQLMWMXFFNAONP-WJEGLXPMSA-N |
| SMILES | C/C(=C\CC[C@@](C)([C@@H](CC1=CNC(=C1)[N+](=O)[O-])O)O)/CC[C@@H](C(C)(C)O)O |
Computed by PubChem (NCBI)