Products 1255717-02-2

CAS 1255717-02-2 is the registry number for 1-Isobutyl-3-methyl-2-piperazinone hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-methyl-1-(2-methylpropyl)piperazin-2-one;hydrobromide (CAS 1255717-02-2) is a chemical compound with the molecular formula C9H19BrN2O and a molecular weight of 251.16 g/mol. IUPAC name: 3-methyl-1-(2-methylpropyl)piperazin-2-one;hydrobromide. InChIKey: CXQUACZXAGKATF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19BrN2O
Molecular weight251.16 g/mol
IUPAC name3-methyl-1-(2-methylpropyl)piperazin-2-one;hydrobromide
InChIKeyCXQUACZXAGKATF-UHFFFAOYSA-N
SMILESCC1C(=O)N(CCN1)CC(C)C.Br

Computed by PubChem (NCBI)