Products 1255717-82-8

CAS 1255717-82-8 is the registry number for (4-Methyl-1,4-diazepan-1-yl)acetic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-methyl-1,4-diazepan-1-yl)acetic acid;hydrate (CAS 1255717-82-8) is a chemical compound with the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. IUPAC name: 2-(4-methyl-1,4-diazepan-1-yl)acetic acid;hydrate. InChIKey: KIMMZYAUCYNZRG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18N2O3
Molecular weight190.24 g/mol
IUPAC name2-(4-methyl-1,4-diazepan-1-yl)acetic acid;hydrate
InChIKeyKIMMZYAUCYNZRG-UHFFFAOYSA-N
SMILESCN1CCCN(CC1)CC(=O)O.O

Computed by PubChem (NCBI)