CAS 1255717-85-1 is the registry number for 1-(3-Phenylpropyl)-1,4-diazepane bis(4-methylbenzenesulfonate), 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.
Bis(4-methylbenzenesulfonic acid);1-(3-phenylpropyl)-1,4-diazepane (CAS 1255717-85-1) is a chemical compound with the molecular formula C28H38N2O6S2 and a molecular weight of 562.7 g/mol. IUPAC name: bis(4-methylbenzenesulfonic acid);1-(3-phenylpropyl)-1,4-diazepane. InChIKey: CWFJQBIACKKRJT-UHFFFAOYSA-N.
| Molecular formula | C28H38N2O6S2 |
|---|---|
| Molecular weight | 562.7 g/mol |
| IUPAC name | bis(4-methylbenzenesulfonic acid);1-(3-phenylpropyl)-1,4-diazepane |
| InChIKey | CWFJQBIACKKRJT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)O.C1CNCCN(C1)CCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)